C14H14O3 — CID 90474399
(4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one (PubChem CID 90474399) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one.
| Compound Name | (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one |
|---|---|
| PubChem CID | 90474399 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one |
| SMILES | C=C(C)[C@@H]1CCC2=COC=CC3=C2[C@H]1OC3=O |
| InChI | InChI=1S/C14H14O3/c1-8(2)10-4-3-9-7-16-6-5-11-12(9)13(10)17-14(11)15/h5-7,10,13H,1,3-4H2,2H3/t10-,13-/m0/s1 |
| InChIKey | WQBPKDLBMOJPGG-GWCFXTLKSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|