About deuterioformate;tetradeuterioazanium
deuterioformate;tetradeuterioazanium (PubChem CID 90474510) has the molecular formula CH5NO2
and a molecular weight of 68.09 g/mol. Its IUPAC name is deuterioformate;tetradeuterioazanium.
Molecular Properties
| Compound Name | deuterioformate;tetradeuterioazanium |
| PubChem CID | 90474510 |
| Molecular Formula | CH5NO2 |
| Molecular Weight | 68.09 g/mol |
| Exact Mass | 68.06 |
| IUPAC Name | deuterioformate;tetradeuterioazanium |
| SMILES | [2H]C(=O)[O-].[2H][N+]([2H])([2H])[2H] |
| InChI | InChI=1S/CH2O2.H3N/c2-1-3;/h1H,(H,2,3);1H3/i1D;/hD4 |
| InChIKey | VZTDIZULWFCMLS-AQOVZKNZSA-N |
| XLogP | -1.26 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 68.09 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze deuterioformate;tetradeuterioazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterioformate;tetradeuterioazanium?
The IUPAC name of deuterioformate;tetradeuterioazanium (CID 90474510) is deuterioformate;tetradeuterioazanium.
What is the SMILES notation for deuterioformate;tetradeuterioazanium?
The canonical SMILES for deuterioformate;tetradeuterioazanium is [2H]C(=O)[O-].[2H][N+]([2H])([2H])[2H].
What is the InChIKey of deuterioformate;tetradeuterioazanium?
The InChIKey is VZTDIZULWFCMLS-AQOVZKNZSA-N. The full InChI is InChI=1S/CH2O2.H3N/c2-1-3;/h1H,(H,2,3);1H3/i1D;/hD4.
What are the key properties of deuterioformate;tetradeuterioazanium?
deuterioformate;tetradeuterioazanium has a molecular weight of 68.09 g/mol, XLogP of -1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuterioformate;tetradeuterioazanium is sourced from PubChem (CID 90474510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).