C20H22ClN — CID 90474628
(3E)-3-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine (PubChem CID 90474628) has the molecular formula C20H22ClN and a molecular weight of 311.86 g/mol. Its IUPAC name is (3E)-3-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3E)-3-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 90474628 |
| Molecular Formula | C20H22ClN |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (3E)-3-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1\c2ccccc2CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H22ClN/c1-22(2)13-5-8-20-18-7-4-3-6-15(18)9-10-16-14-17(21)11-12-19(16)20/h3-4,6-8,11-12,14H,5,9-10,13H2,1-2H3/b20-8+ |
| InChIKey | MHEJPSDWAIXVHL-DNTJNYDQSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|