About (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile
(2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile (PubChem CID 90474653) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile |
| PubChem CID | 90474653 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile |
| SMILES | N#C/C=C1/Nc2ccccc2NC1=O |
| InChI | InChI=1S/C10H7N3O/c11-6-5-9-10(14)13-8-4-2-1-3-7(8)12-9/h1-5,12H,(H,13,14)/b9-5+ |
| InChIKey | KNQRYDWDIMUVMO-WEVVVXLNSA-N |
| XLogP | 1.46 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile?
The IUPAC name of (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile (CID 90474653) is (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile.
What is the SMILES notation for (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile?
The canonical SMILES for (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile is N#C/C=C1/Nc2ccccc2NC1=O.
What is the InChIKey of (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile?
The InChIKey is KNQRYDWDIMUVMO-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H7N3O/c11-6-5-9-10(14)13-8-4-2-1-3-7(8)12-9/h1-5,12H,(H,13,14)/b9-5+.
What are the key properties of (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile?
(2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile has a molecular weight of 185.19 g/mol, XLogP of 1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3-oxo-1,4-dihydroquinoxalin-2-ylidene)acetonitrile is sourced from PubChem (CID 90474653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).