C29H39N5O4 — CID 90474859
azanium 5-cyano-3-[(E,3Z)-3-(5-cyano-1-hexyl-4-methyl-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-1-hexyl-4-methyl-6-oxopyridin-2-olate (PubChem CID 90474859) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is azanium 5-cyano-3-[(E,3Z)-3-(5-cyano-1-hexyl-4-methyl-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-1-hexyl-4-methyl-6-oxopyridin-2-olate.
| Compound Name | azanium 5-cyano-3-[(E,3Z)-3-(5-cyano-1-hexyl-4-methyl-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-1-hexyl-4-methyl-6-oxopyridin-2-olate |
|---|---|
| PubChem CID | 90474859 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | azanium 5-cyano-3-[(E,3Z)-3-(5-cyano-1-hexyl-4-methyl-2,6-dioxo-3-pyridinylidene)prop-1-enyl]-1-hexyl-4-methyl-6-oxopyridin-2-olate |
| SMILES | CCCCCCN1C(=O)C(C#N)=C(C)/C(=C/C=C/c2c(C)c(C#N)c(=O)n(CCCCCC)c2[O-])C1=O.[NH4+] |
| InChI | InChI=1S/C29H36N4O4.H3N/c1-5-7-9-11-16-32-26(34)22(20(3)24(18-30)28(32)36)14-13-15-23-21(4)25(19-31)29(37)33(27(23)35)17-12-10-8-6-2;/h13-15,34H,5-12,16-17H2,1-4H3;1H3/b14-13+,23-15-; |
| InChIKey | NCIINKBTEAJJFH-OJJCFAEVSA-N |
| XLogP | 4.79 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|