C25H34N4O3 — CID 90475800
1-N,1-N-diethyl-4-N-(9-hydroperoxy-5-methyl-6H-pyrido[4,3-b]carbazol-1-yl)pentane-1,4-diamine;hydrate (PubChem CID 90475800) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(9-hydroperoxy-5-methyl-6H-pyrido[4,3-b]carbazol-1-yl)pentane-1,4-diamine;hydrate.
| Compound Name | 1-N,1-N-diethyl-4-N-(9-hydroperoxy-5-methyl-6H-pyrido[4,3-b]carbazol-1-yl)pentane-1,4-diamine;hydrate |
|---|---|
| PubChem CID | 90475800 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(9-hydroperoxy-5-methyl-6H-pyrido[4,3-b]carbazol-1-yl)pentane-1,4-diamine;hydrate |
| SMILES | CCN(CC)CCCC(C)Nc1nccc2c(C)c3[nH]c4ccc(OO)cc4c3cc12.O |
| InChI | InChI=1S/C25H32N4O2.H2O/c1-5-29(6-2)13-7-8-16(3)27-25-22-15-21-20-14-18(31-30)9-10-23(20)28-24(21)17(4)19(22)11-12-26-25;/h9-12,14-16,28,30H,5-8,13H2,1-4H3,(H,26,27);1H2 |
| InChIKey | ULFHFMZYYXFXSL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|