About (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine
(E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine (PubChem CID 90476336) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine.
Molecular Properties
| Compound Name | (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine |
| PubChem CID | 90476336 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine |
| SMILES | Cc1cn(C)/c(=N\N)n1C |
| InChI | InChI=1S/C6H12N4/c1-5-4-9(2)6(8-7)10(5)3/h4H,7H2,1-3H3/b8-6+ |
| InChIKey | KNJDIFVHYRZMRG-SOFGYWHQSA-N |
| XLogP | -0.55 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine?
The IUPAC name of (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine (CID 90476336) is (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine.
What is the SMILES notation for (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine?
The canonical SMILES for (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine is Cc1cn(C)/c(=N\N)n1C.
What is the InChIKey of (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine?
The InChIKey is KNJDIFVHYRZMRG-SOFGYWHQSA-N. The full InChI is InChI=1S/C6H12N4/c1-5-4-9(2)6(8-7)10(5)3/h4H,7H2,1-3H3/b8-6+.
What are the key properties of (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine?
(E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine has a molecular weight of 140.19 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(1,3,4-trimethylimidazol-2-ylidene)hydrazine is sourced from PubChem (CID 90476336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).