C10H15NO4 — CID 90476392
(1R,3R,4S,8R,10S)-4,10-dimethyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one (PubChem CID 90476392) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is (1R,3R,4S,8R,10S)-4,10-dimethyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one.
| Compound Name | (1R,3R,4S,8R,10S)-4,10-dimethyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one |
|---|---|
| PubChem CID | 90476392 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (1R,3R,4S,8R,10S)-4,10-dimethyl-2,9,11-trioxa-6-azatricyclo[6.4.0.03,6]dodecan-5-one |
| SMILES | C[C@H]1OC[C@H]2O[C@@H]3[C@H](C)C(=O)N3C[C@H]2O1 |
| InChI | InChI=1S/C10H15NO4/c1-5-9(12)11-3-7-8(15-10(5)11)4-13-6(2)14-7/h5-8,10H,3-4H2,1-2H3/t5-,6+,7-,8-,10-/m1/s1 |
| InChIKey | LABCHFGDUPQQPV-MGPZHUSASA-N |
| XLogP | -0.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |