C10H16O2 — CID 90476648
[(1R,5R,7R)-4,7-dimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-yl]methanol (PubChem CID 90476648) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is [(1R,5R,7R)-4,7-dimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-yl]methanol.
| Compound Name | [(1R,5R,7R)-4,7-dimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-yl]methanol |
|---|---|
| PubChem CID | 90476648 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | [(1R,5R,7R)-4,7-dimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-yl]methanol |
| SMILES | CC1=CC[C@@H]2C[C@H]1O[C@@]2(C)CO |
| InChI | InChI=1S/C10H16O2/c1-7-3-4-8-5-9(7)12-10(8,2)6-11/h3,8-9,11H,4-6H2,1-2H3/t8-,9-,10+/m1/s1 |
| InChIKey | CTNONMWSJRMRCY-BBBLOLIVSA-N |
| XLogP | 1.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|