C18H25NO12 — CID 90476772
[(2R,3R,4S,5R,6R)-6-[acetyl(acetyloxy)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 90476772) has the molecular formula C18H25NO12 and a molecular weight of 447.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[acetyl(acetyloxy)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[acetyl(acetyloxy)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90476772 |
| Molecular Formula | C18H25NO12 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[acetyl(acetyloxy)amino]-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N(OC(C)=O)C(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H25NO12/c1-8(20)19(31-13(6)25)18-17(29-12(5)24)16(28-11(4)23)15(27-10(3)22)14(30-18)7-26-9(2)21/h14-18H,7H2,1-6H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | YXQZXMNFNOMHIH-UYTYNIKBSA-N |
| XLogP | -0.60 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|