C4H3F5O — CID 90476807
(E)-1,1,3,4,4-pentafluorobut-2-en-2-ol (PubChem CID 90476807) has the molecular formula C4H3F5O and a molecular weight of 162.06 g/mol. Its IUPAC name is (E)-1,1,3,4,4-pentafluorobut-2-en-2-ol.
| Compound Name | (E)-1,1,3,4,4-pentafluorobut-2-en-2-ol |
|---|---|
| PubChem CID | 90476807 |
| Molecular Formula | C4H3F5O |
| Molecular Weight | 162.06 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | (E)-1,1,3,4,4-pentafluorobut-2-en-2-ol |
| SMILES | O/C(=C(/F)C(F)F)C(F)F |
| InChI | InChI=1S/C4H3F5O/c5-1(3(6)7)2(10)4(8)9/h3-4,10H/b2-1+ |
| InChIKey | NSVLCBLSLHTSLD-OWOJBTEDSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|