C50H96O9 — CID 90476923
(6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-6,10,38-triene-1,2,3,15,19,23,27,31,35-nonol (PubChem CID 90476923) has the molecular formula C50H96O9 and a molecular weight of 841.31 g/mol. Its IUPAC name is (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-6,10,38-triene-1,2,3,15,19,23,27,31,35-nonol.
| Compound Name | (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-6,10,38-triene-1,2,3,15,19,23,27,31,35-nonol |
|---|---|
| PubChem CID | 90476923 |
| Molecular Formula | C50H96O9 |
| Molecular Weight | 841.31 g/mol |
| Exact Mass | 840.71 |
| IUPAC Name | (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-6,10,38-triene-1,2,3,15,19,23,27,31,35-nonol |
| SMILES | CC(C)=CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC/C(C)=C/CC/C(C)=C/CCC(C)(O)C(O)CO |
| InChI | InChI=1S/C50H96O9/c1-40(2)21-13-26-44(5,53)28-16-30-46(7,55)32-18-34-48(9,57)36-20-37-49(10,58)35-19-33-47(8,56)31-17-29-45(6,54)27-14-24-41(3)22-12-23-42(4)25-15-38-50(11,59)43(52)39-51/h21-22,25,43,51-59H,12-20,23-24,26-39H2,1-11H3/b41-22+,42-25+ |
| InChIKey | GXRSXYPYBMUEGP-LBXWGWHDSA-N |
| XLogP | 9.82 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.31 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|