[2-(piperidine-1-carbonyl)phenyl]boronic acid

C12H16BNO3 — CID 90477220

IUPAC[2-(piperidine-1-carbonyl)phenyl]boronic acid
SMILESO=C(c1ccccc1B(O)O)N1CCCCC1
InChIInChI=1S/C12H16BNO3/c15-12(14-8-4-1-5-9-14)10-6-2-3-7-11(10)13(16)17/h2-3,6-7,16-17H,1,4-5,8-9H2
InChIKeyNZLRMOMHBWMLCA-UHFFFAOYSA-N
MW233.08 g/mol
LogP-0.01
Rot. Bonds2

About [2-(piperidine-1-carbonyl)phenyl]boronic acid

[2-(piperidine-1-carbonyl)phenyl]boronic acid (PubChem CID 90477220) has the molecular formula C12H16BNO3 and a molecular weight of 233.08 g/mol. Its IUPAC name is [2-(piperidine-1-carbonyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2-(piperidine-1-carbonyl)phenyl]boronic acid
PubChem CID90477220
Molecular FormulaC12H16BNO3
Molecular Weight233.08 g/mol
Exact Mass233.12
IUPAC Name[2-(piperidine-1-carbonyl)phenyl]boronic acid
SMILESO=C(c1ccccc1B(O)O)N1CCCCC1
InChIInChI=1S/C12H16BNO3/c15-12(14-8-4-1-5-9-14)10-6-2-3-7-11(10)13(16)17/h2-3,6-7,16-17H,1,4-5,8-9H2
InChIKeyNZLRMOMHBWMLCA-UHFFFAOYSA-N
XLogP-0.01
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.08
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(piperidine-1-carbonyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(piperidine-1-carbonyl)phenyl]boronic acid?
The IUPAC name of [2-(piperidine-1-carbonyl)phenyl]boronic acid (CID 90477220) is [2-(piperidine-1-carbonyl)phenyl]boronic acid.
What is the SMILES notation for [2-(piperidine-1-carbonyl)phenyl]boronic acid?
The canonical SMILES for [2-(piperidine-1-carbonyl)phenyl]boronic acid is O=C(c1ccccc1B(O)O)N1CCCCC1.
What is the InChIKey of [2-(piperidine-1-carbonyl)phenyl]boronic acid?
The InChIKey is NZLRMOMHBWMLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BNO3/c15-12(14-8-4-1-5-9-14)10-6-2-3-7-11(10)13(16)17/h2-3,6-7,16-17H,1,4-5,8-9H2.
What are the key properties of [2-(piperidine-1-carbonyl)phenyl]boronic acid?
[2-(piperidine-1-carbonyl)phenyl]boronic acid has a molecular weight of 233.08 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(piperidine-1-carbonyl)phenyl]boronic acid is sourced from PubChem (CID 90477220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).