C20H32O — CID 90477416
(1R,2Z,6S,7Z,9Z,12Z)-3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-2,7,9,12-tetraen-1-ol (PubChem CID 90477416) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1R,2Z,6S,7Z,9Z,12Z)-3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-2,7,9,12-tetraen-1-ol.
| Compound Name | (1R,2Z,6S,7Z,9Z,12Z)-3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-2,7,9,12-tetraen-1-ol |
|---|---|
| PubChem CID | 90477416 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1R,2Z,6S,7Z,9Z,12Z)-3,9,13-trimethyl-6-propan-2-ylcyclotetradeca-2,7,9,12-tetraen-1-ol |
| SMILES | CC1=C/C/C=C(/C)C[C@@H](O)/C=C(/C)CC[C@@H](C(C)C)/C=C\1 |
| InChI | InChI=1S/C20H32O/c1-15(2)19-11-9-16(3)7-6-8-17(4)13-20(21)14-18(5)10-12-19/h7-9,11,14-15,19-21H,6,10,12-13H2,1-5H3/b11-9-,16-7-,17-8-,18-14-/t19-,20+/m0/s1 |
| InChIKey | UISPGBUXWMMCCP-CPPGVPBOSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|