About 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid
6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid (PubChem CID 90478004) has the molecular formula C12H7BrN2O2S
and a molecular weight of 323.17 g/mol. Its IUPAC name is 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid.
Analyze 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The IUPAC name of 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid (CID 90478004) is 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid.
What is the SMILES notation for 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The canonical SMILES for 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid is O=C(O)c1csc2nc(-c3cccc(Br)c3)cn12.
What is the InChIKey of 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The InChIKey is VALRASYDSTUACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrN2O2S/c13-8-3-1-2-7(4-8)9-5-15-10(11(16)17)6-18-12(15)14-9/h1-6H,(H,16,17).
What are the key properties of 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid has a molecular weight of 323.17 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid is sourced from PubChem (CID 90478004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).