C9H14O3 — CID 90478005
2-methylidene-6-(prop-2-enoxymethyl)-1,4-dioxane (PubChem CID 90478005) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methylidene-6-(prop-2-enoxymethyl)-1,4-dioxane.
| Compound Name | 2-methylidene-6-(prop-2-enoxymethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 90478005 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-methylidene-6-(prop-2-enoxymethyl)-1,4-dioxane |
| SMILES | C=CCOCC1COCC(=C)O1 |
| InChI | InChI=1S/C9H14O3/c1-3-4-10-6-9-7-11-5-8(2)12-9/h3,9H,1-2,4-7H2 |
| InChIKey | HJIDFUKBTRGHFI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|