About disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate
disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate (PubChem CID 90478242) has the molecular formula C8H13NNa2O6
and a molecular weight of 265.17 g/mol. Its IUPAC name is disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate.
Molecular Properties
| Compound Name | disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate |
| PubChem CID | 90478242 |
| Molecular Formula | C8H13NNa2O6 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate |
| SMILES | CCN(CC(=O)[O-])[C@@H](OCCO)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H15NO6.2Na/c1-2-9(5-6(11)12)7(8(13)14)15-4-3-10;;/h7,10H,2-5H2,1H3,(H,11,12)(H,13,14);;/q;2*+1/p-2/t7-;;/m0../s1 |
| InChIKey | GMVIIFBLHMULRI-KLXURFKVSA-L |
| XLogP | -9.85 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | -9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate?
The IUPAC name of disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate (CID 90478242) is disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate.
What is the SMILES notation for disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate?
The canonical SMILES for disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate is CCN(CC(=O)[O-])[C@@H](OCCO)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate?
The InChIKey is GMVIIFBLHMULRI-KLXURFKVSA-L. The full InChI is InChI=1S/C8H15NO6.2Na/c1-2-9(5-6(11)12)7(8(13)14)15-4-3-10;;/h7,10H,2-5H2,1H3,(H,11,12)(H,13,14);;/q;2*+1/p-2/t7-;;/m0../s1.
What are the key properties of disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate?
disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate has a molecular weight of 265.17 g/mol, XLogP of -9.85, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate is sourced from PubChem (CID 90478242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).