C12H20INO — CID 90478407
(4R,7S,7aS)-2,2,4,7-tetramethyl-3,4,7,7a-tetrahydro-1H-cyclopenta[c]pyridin-2-ium-6-one iodide (PubChem CID 90478407) has the molecular formula C12H20INO and a molecular weight of 321.20 g/mol. Its IUPAC name is (4R,7S,7aS)-2,2,4,7-tetramethyl-3,4,7,7a-tetrahydro-1H-cyclopenta[c]pyridin-2-ium-6-one iodide.
| Compound Name | (4R,7S,7aS)-2,2,4,7-tetramethyl-3,4,7,7a-tetrahydro-1H-cyclopenta[c]pyridin-2-ium-6-one iodide |
|---|---|
| PubChem CID | 90478407 |
| Molecular Formula | C12H20INO |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (4R,7S,7aS)-2,2,4,7-tetramethyl-3,4,7,7a-tetrahydro-1H-cyclopenta[c]pyridin-2-ium-6-one iodide |
| SMILES | C[C@@H]1C(=O)C=C2[C@H]1C[N+](C)(C)C[C@@H]2C.[I-] |
| InChI | InChI=1S/C12H20NO.HI/c1-8-6-13(3,4)7-11-9(2)12(14)5-10(8)11;/h5,8-9,11H,6-7H2,1-4H3;1H/q+1;/p-1/t8-,9-,11-;/m0./s1 |
| InChIKey | MKDKOSRHKGYNDP-GRIHUTHFSA-M |
| XLogP | -1.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|