C19H37NO — CID 90478669
10-[(1R,2S)-2-hexylcyclopropyl]decanamide (PubChem CID 90478669) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is 10-[(1R,2S)-2-hexylcyclopropyl]decanamide.
| Compound Name | 10-[(1R,2S)-2-hexylcyclopropyl]decanamide |
|---|---|
| PubChem CID | 90478669 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | 10-[(1R,2S)-2-hexylcyclopropyl]decanamide |
| SMILES | CCCCCC[C@H]1C[C@H]1CCCCCCCCCC(N)=O |
| InChI | InChI=1S/C19H37NO/c1-2-3-4-10-13-17-16-18(17)14-11-8-6-5-7-9-12-15-19(20)21/h17-18H,2-16H2,1H3,(H2,20,21)/t17-,18+/m0/s1 |
| InChIKey | VAANKLYFVYJWDC-ZWKOTPCHSA-N |
| XLogP | 5.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|