About (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate (PubChem CID 90478671) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate.
Molecular Properties
| Compound Name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate |
| PubChem CID | 90478671 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate |
| SMILES | CN1[C@@H]2CCC[C@H]1CC(=O)C2.O.O |
| InChI | InChI=1S/C9H15NO.2H2O/c1-10-7-3-2-4-8(10)6-9(11)5-7;;/h7-8H,2-6H2,1H3;2*1H2/t7-,8+;; |
| InChIKey | NZAPDOMRSHZHNJ-QFHMQQKOSA-N |
| XLogP | -0.45 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate?
The IUPAC name of (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate (CID 90478671) is (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate.
What is the SMILES notation for (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate?
The canonical SMILES for (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate is CN1[C@@H]2CCC[C@H]1CC(=O)C2.O.O.
What is the InChIKey of (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate?
The InChIKey is NZAPDOMRSHZHNJ-QFHMQQKOSA-N. The full InChI is InChI=1S/C9H15NO.2H2O/c1-10-7-3-2-4-8(10)6-9(11)5-7;;/h7-8H,2-6H2,1H3;2*1H2/t7-,8+;;.
What are the key properties of (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate?
(1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate has a molecular weight of 189.25 g/mol, XLogP of -0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-one;dihydrate is sourced from PubChem (CID 90478671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).