C12H3Br7 — CID 90478698
1,2,3,4,5-pentabromo-6-(3,5-dibromophenyl)benzene (PubChem CID 90478698) has the molecular formula C12H3Br7 and a molecular weight of 706.48 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-(3,5-dibromophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-(3,5-dibromophenyl)benzene |
|---|---|
| PubChem CID | 90478698 |
| Molecular Formula | C12H3Br7 |
| Molecular Weight | 706.48 g/mol |
| Exact Mass | 699.45 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-(3,5-dibromophenyl)benzene |
| SMILES | Brc1cc(Br)cc(-c2c(Br)c(Br)c(Br)c(Br)c2Br)c1 |
| InChI | InChI=1S/C12H3Br7/c13-5-1-4(2-6(14)3-5)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
| InChIKey | FERSPRIXLHELTC-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.48 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|