C16H20O5 — CID 90480117
4-(7-benzyl-1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)butan-2-one (PubChem CID 90480117) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(7-benzyl-1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)butan-2-one.
| Compound Name | 4-(7-benzyl-1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)butan-2-one |
|---|---|
| PubChem CID | 90480117 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-(7-benzyl-1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)butan-2-one |
| SMILES | CC(=O)CCC1(Cc2ccccc2)C2(C)OOC1(C)OO2 |
| InChI | InChI=1S/C16H20O5/c1-12(17)9-10-16(11-13-7-5-4-6-8-13)14(2)18-20-15(16,3)21-19-14/h4-8H,9-11H2,1-3H3 |
| InChIKey | PSTWYNWGUFKBNQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|