C28H28BrClN4O — CID 90480399
8-bromo-N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 90480399) has the molecular formula C28H28BrClN4O and a molecular weight of 551.92 g/mol. Its IUPAC name is 8-bromo-N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 8-bromo-N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90480399 |
| Molecular Formula | C28H28BrClN4O |
| Molecular Weight | 551.92 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 8-bromo-N-[[4-[4-(4-chlorophenyl)piperidin-1-yl]phenyl]methyl]-2-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2c(Br)cccn2c1C(=O)NCc1ccc(N2CCC(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H28BrClN4O/c1-2-25-26(34-15-3-4-24(29)27(34)32-25)28(35)31-18-19-5-11-23(12-6-19)33-16-13-21(14-17-33)20-7-9-22(30)10-8-20/h3-12,15,21H,2,13-14,16-18H2,1H3,(H,31,35) |
| InChIKey | BVPHNIHWDIMBJD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.92 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|