C30H40N2O8 — CID 90480498
[(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanoate (PubChem CID 90480498) has the molecular formula C30H40N2O8 and a molecular weight of 556.66 g/mol. Its IUPAC name is [(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanoate.
| Compound Name | [(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanoate |
|---|---|
| PubChem CID | 90480498 |
| Molecular Formula | C30H40N2O8 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | [(5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butanoate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)N3CC4CC(C3)c3cccc(=O)n3C4)O[C@@H]3OC4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C30H40N2O8/c1-17-7-8-22-18(2)27(37-28-30(22)21(17)11-12-29(3,38-28)39-40-30)36-26(35)10-9-24(33)31-14-19-13-20(16-31)23-5-4-6-25(34)32(23)15-19/h4-6,17-22,27-28H,7-16H2,1-3H3/t17-,18-,19?,20?,21?,22?,27-,28-,29?,30-/m1/s1 |
| InChIKey | ZNQOPMBNBKGFCU-AZOLRRRPSA-N |
| XLogP | 3.33 |
| TPSA | 105.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|