About N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide
N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 90480595) has the molecular formula C8H13N3O3S2
and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 90480595 |
| Molecular Formula | C8H13N3O3S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCNS(=O)(=O)c1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C8H13N3O3S2/c1-3-4-10-16(13,14)7-5-9-8(15-7)11-6(2)12/h5,10H,3-4H2,1-2H3,(H,9,11,12) |
| InChIKey | JGWXSKQGKIQFDG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide (CID 90480595) is N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide is CCCNS(=O)(=O)c1cnc(NC(C)=O)s1.
What is the InChIKey of N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is JGWXSKQGKIQFDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3S2/c1-3-4-10-16(13,14)7-5-9-8(15-7)11-6(2)12/h5,10H,3-4H2,1-2H3,(H,9,11,12).
What are the key properties of N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide?
N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 263.34 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(propylsulfamoyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 90480595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).