About [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium
[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium (PubChem CID 9048101) has the molecular formula C17H17BrFN2S+
and a molecular weight of 380.31 g/mol. Its IUPAC name is [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium.
Molecular Properties
| Compound Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium |
| PubChem CID | 9048101 |
| Molecular Formula | C17H17BrFN2S+ |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium |
| SMILES | C[C@H](c1nc2ccccc2s1)[NH+](C)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H16BrFN2S/c1-11(17-20-15-5-3-4-6-16(15)22-17)21(2)10-12-7-8-13(18)9-14(12)19/h3-9,11H,10H2,1-2H3/p+1/t11-/m1/s1 |
| InChIKey | AZETWMGGLDRJGI-LLVKDONJSA-O |
| XLogP | 3.97 |
| TPSA | 17.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium?
The IUPAC name of [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium (CID 9048101) is [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium.
What is the SMILES notation for [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium?
The canonical SMILES for [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium is C[C@H](c1nc2ccccc2s1)[NH+](C)Cc1ccc(Br)cc1F.
What is the InChIKey of [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium?
The InChIKey is AZETWMGGLDRJGI-LLVKDONJSA-O. The full InChI is InChI=1S/C17H16BrFN2S/c1-11(17-20-15-5-3-4-6-16(15)22-17)21(2)10-12-7-8-13(18)9-14(12)19/h3-9,11H,10H2,1-2H3/p+1/t11-/m1/s1.
What are the key properties of [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium?
[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium has a molecular weight of 380.31 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(4-bromo-2-fluorophenyl)methyl]-methylazanium is sourced from PubChem (CID 9048101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).