About (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine
(1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine (PubChem CID 9048102) has the molecular formula C17H16BrFN2S
and a molecular weight of 379.30 g/mol. Its IUPAC name is (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine |
| PubChem CID | 9048102 |
| Molecular Formula | C17H16BrFN2S |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H16BrFN2S/c1-11(17-20-15-5-3-4-6-16(15)22-17)21(2)10-12-7-8-13(18)9-14(12)19/h3-9,11H,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | AZETWMGGLDRJGI-LLVKDONJSA-N |
| XLogP | 5.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine?
The IUPAC name of (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine (CID 9048102) is (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine.
What is the SMILES notation for (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine?
The canonical SMILES for (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine is C[C@H](c1nc2ccccc2s1)N(C)Cc1ccc(Br)cc1F.
What is the InChIKey of (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine?
The InChIKey is AZETWMGGLDRJGI-LLVKDONJSA-N. The full InChI is InChI=1S/C17H16BrFN2S/c1-11(17-20-15-5-3-4-6-16(15)22-17)21(2)10-12-7-8-13(18)9-14(12)19/h3-9,11H,10H2,1-2H3/t11-/m1/s1.
What are the key properties of (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine?
(1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine has a molecular weight of 379.30 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(1,3-benzothiazol-2-yl)-N-[(4-bromo-2-fluorophenyl)methyl]-N-methylethanamine is sourced from PubChem (CID 9048102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).