About 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine
3-N,1-di(propan-2-yl)pyrazole-3,4-diamine (PubChem CID 90481048) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine |
| PubChem CID | 90481048 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine |
| SMILES | CC(C)Nc1nn(C(C)C)cc1N |
| InChI | InChI=1S/C9H18N4/c1-6(2)11-9-8(10)5-13(12-9)7(3)4/h5-7H,10H2,1-4H3,(H,11,12) |
| InChIKey | RJFQBEMLUPKGSV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine?
The IUPAC name of 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine (CID 90481048) is 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine.
What is the SMILES notation for 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine?
The canonical SMILES for 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine is CC(C)Nc1nn(C(C)C)cc1N.
What is the InChIKey of 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine?
The InChIKey is RJFQBEMLUPKGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-6(2)11-9-8(10)5-13(12-9)7(3)4/h5-7H,10H2,1-4H3,(H,11,12).
What are the key properties of 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine?
3-N,1-di(propan-2-yl)pyrazole-3,4-diamine has a molecular weight of 182.27 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,1-di(propan-2-yl)pyrazole-3,4-diamine is sourced from PubChem (CID 90481048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).