C30H25N7O5 — CID 90481369
(Z)-1-(3,4-dimethoxyphenyl)-N-[[16-(furan-2-yl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]methanimine (PubChem CID 90481369) has the molecular formula C30H25N7O5 and a molecular weight of 563.57 g/mol. Its IUPAC name is (Z)-1-(3,4-dimethoxyphenyl)-N-[[16-(furan-2-yl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(3,4-dimethoxyphenyl)-N-[[16-(furan-2-yl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 90481369 |
| Molecular Formula | C30H25N7O5 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | (Z)-1-(3,4-dimethoxyphenyl)-N-[[16-(furan-2-yl)-14-methyl-12-phenyl-10-oxa-3,5,6,8,12,13-hexazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2,4,7,11(15),13-hexaen-4-yl]methoxy]methanimine |
| SMILES | COc1ccc(/C=N\OCc2nc3c4c(ncn3n2)Oc2c(c(C)nn2-c2ccccc2)C4c2ccco2)cc1OC |
| InChI | InChI=1S/C30H25N7O5/c1-18-25-26(22-10-7-13-40-22)27-28-33-24(16-41-32-15-19-11-12-21(38-2)23(14-19)39-3)35-36(28)17-31-29(27)42-30(25)37(34-18)20-8-5-4-6-9-20/h4-15,17,26H,16H2,1-3H3/b32-15- |
| InChIKey | SAETTWUXJQIOON-CNCDYAKUSA-N |
| XLogP | 5.07 |
| TPSA | 123.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|