C12H9ClN2O3S — CID 90481542
ethyl 11-chloro-5-hydroxy-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxylate (PubChem CID 90481542) has the molecular formula C12H9ClN2O3S and a molecular weight of 296.74 g/mol. Its IUPAC name is ethyl 11-chloro-5-hydroxy-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxylate.
| Compound Name | ethyl 11-chloro-5-hydroxy-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 90481542 |
| Molecular Formula | C12H9ClN2O3S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | ethyl 11-chloro-5-hydroxy-3-thia-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1sc2c(nc3ccc(Cl)cn32)c1O |
| InChI | InChI=1S/C12H9ClN2O3S/c1-2-18-12(17)10-9(16)8-11(19-10)15-5-6(13)3-4-7(15)14-8/h3-5,16H,2H2,1H3 |
| InChIKey | UQOYFRCCCCLMJA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|