C6H3BrN6 — CID 90481610
10-bromo-3,4,5,6,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene (PubChem CID 90481610) has the molecular formula C6H3BrN6 and a molecular weight of 239.04 g/mol. Its IUPAC name is 10-bromo-3,4,5,6,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene.
| Compound Name | 10-bromo-3,4,5,6,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
|---|---|
| PubChem CID | 90481610 |
| Molecular Formula | C6H3BrN6 |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 10-bromo-3,4,5,6,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
| SMILES | Brc1[nH]nc2c1ccn1nnnc21 |
| InChI | InChI=1S/C6H3BrN6/c7-5-3-1-2-13-6(10-11-12-13)4(3)8-9-5/h1-2H,(H,8,9) |
| InChIKey | YXZLMDOGFSJGCL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |