C15H11N5O2 — CID 90481962
methyl 8,8,9,9-tetracyano-6-methyl-2-azabicyclo[3.2.2]nona-3,6-diene-2-carboxylate (PubChem CID 90481962) has the molecular formula C15H11N5O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is methyl 8,8,9,9-tetracyano-6-methyl-2-azabicyclo[3.2.2]nona-3,6-diene-2-carboxylate.
| Compound Name | methyl 8,8,9,9-tetracyano-6-methyl-2-azabicyclo[3.2.2]nona-3,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 90481962 |
| Molecular Formula | C15H11N5O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | methyl 8,8,9,9-tetracyano-6-methyl-2-azabicyclo[3.2.2]nona-3,6-diene-2-carboxylate |
| SMILES | COC(=O)N1C=CC2C(C)=CC1C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C15H11N5O2/c1-10-5-12-15(8-18,9-19)14(6-16,7-17)11(10)3-4-20(12)13(21)22-2/h3-5,11-12H,1-2H3 |
| InChIKey | NNRLQSHJFYVKPQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 124.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|