About 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione
4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione (PubChem CID 90482043) has the molecular formula C9H9NS
and a molecular weight of 163.25 g/mol. Its IUPAC name is 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione.
Molecular Properties
| Compound Name | 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione |
| PubChem CID | 90482043 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione |
| SMILES | S=C1NC2C=CC3C(C=C2)C13 |
| InChI | InChI=1S/C9H9NS/c11-9-8-6-3-1-5(10-9)2-4-7(6)8/h1-8H,(H,10,11) |
| InChIKey | LCPJWAXSTMXSAZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione?
The IUPAC name of 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione (CID 90482043) is 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione.
What is the SMILES notation for 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione?
The canonical SMILES for 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione is S=C1NC2C=CC3C(C=C2)C13.
What is the InChIKey of 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione?
The InChIKey is LCPJWAXSTMXSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS/c11-9-8-6-3-1-5(10-9)2-4-7(6)8/h1-8H,(H,10,11).
What are the key properties of 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione?
4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione has a molecular weight of 163.25 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[3.3.2.02,8]deca-6,9-diene-3-thione is sourced from PubChem (CID 90482043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).