C17H15N — CID 90482134
9-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenylmethanamine (PubChem CID 90482134) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 9-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenylmethanamine.
| Compound Name | 9-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenylmethanamine |
|---|---|
| PubChem CID | 90482134 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 9-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaenylmethanamine |
| SMILES | NCC12c3ccccc3C3C(c4ccccc41)C32 |
| InChI | InChI=1S/C17H15N/c18-9-17-12-7-3-1-5-10(12)14-15(16(14)17)11-6-2-4-8-13(11)17/h1-8,14-16H,9,18H2 |
| InChIKey | IRIFPDNYPYWIRM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |