C20H17N3O2 — CID 90482165
15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,9.07,12.08,11.013,17]heptadec-4-ene-14,16-dione (PubChem CID 90482165) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,9.07,12.08,11.013,17]heptadec-4-ene-14,16-dione.
| Compound Name | 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,9.07,12.08,11.013,17]heptadec-4-ene-14,16-dione |
|---|---|
| PubChem CID | 90482165 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,9.07,12.08,11.013,17]heptadec-4-ene-14,16-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1C3C4C5C3C13CC=CCC53C42 |
| InChI | InChI=1S/C20H17N3O2/c24-17-21(10-6-2-1-3-7-10)18(25)23-16-12-11-13-14(12)20(16)9-5-4-8-19(13,20)15(11)22(17)23/h1-7,11-16H,8-9H2 |
| InChIKey | VJTMZINAWGVKDV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|