C20H15N3O3 — CID 90482274
15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-5-ene-4,14,16-trione (PubChem CID 90482274) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-5-ene-4,14,16-trione.
| Compound Name | 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-5-ene-4,14,16-trione |
|---|---|
| PubChem CID | 90482274 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 15-phenyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-5-ene-4,14,16-trione |
| SMILES | O=C1C=CC23C4C5C6C5C2C3(C1)C6n1c(=O)n(-c2ccccc2)c(=O)n14 |
| InChI | InChI=1S/C20H15N3O3/c24-10-6-7-19-14-11-12-13(11)16(20(14,19)8-10)23-18(26)21(9-4-2-1-3-5-9)17(25)22(23)15(12)19/h1-7,11-16H,8H2 |
| InChIKey | VTZFPEJCFLLINX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |