C18H10N4 — CID 90482300
(2R,5R,6Z,8Z)-tricyclo[8.4.0.02,5]tetradeca-1(14),6,8,10,12-pentaene-3,3,4,4-tetracarbonitrile (PubChem CID 90482300) has the molecular formula C18H10N4 and a molecular weight of 282.31 g/mol. Its IUPAC name is (2R,5R,6Z,8Z)-tricyclo[8.4.0.02,5]tetradeca-1(14),6,8,10,12-pentaene-3,3,4,4-tetracarbonitrile.
| Compound Name | (2R,5R,6Z,8Z)-tricyclo[8.4.0.02,5]tetradeca-1(14),6,8,10,12-pentaene-3,3,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 90482300 |
| Molecular Formula | C18H10N4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R,5R,6Z,8Z)-tricyclo[8.4.0.02,5]tetradeca-1(14),6,8,10,12-pentaene-3,3,4,4-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@@H]2/C=C\C=C/c3ccccc3[C@@H]2C1(C#N)C#N |
| InChI | InChI=1S/C18H10N4/c19-9-17(10-20)15-8-4-2-6-13-5-1-3-7-14(13)16(15)18(17,11-21)12-22/h1-8,15-16H/b6-2-,8-4-/t15-,16+/m1/s1 |
| InChIKey | RIFRXEUHYHKFPK-BZNYHCDRSA-N |
| XLogP | 3.05 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|