C12H12O4 — CID 90482334
(1S,4S,5S,6R,9S,10S,11S)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylic acid (PubChem CID 90482334) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (1S,4S,5S,6R,9S,10S,11S)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylic acid.
| Compound Name | (1S,4S,5S,6R,9S,10S,11S)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 90482334 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1S,4S,5S,6R,9S,10S,11S)-3-oxo-2-oxatetracyclo[7.2.1.04,11.06,10]dodec-7-ene-5-carboxylic acid |
| SMILES | O=C1O[C@H]2C[C@H]3C=C[C@H]4[C@H](C(=O)O)[C@@H]1[C@@H]2[C@H]43 |
| InChI | InChI=1S/C12H12O4/c13-11(14)8-5-2-1-4-3-6-9(7(4)5)10(8)12(15)16-6/h1-2,4-10H,3H2,(H,13,14)/t4-,5-,6+,7+,8+,9+,10-/m1/s1 |
| InChIKey | AMYYBIVBXBNUBS-AQMWJAJYSA-N |
| XLogP | 0.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|