C15H15N3O4S — CID 90482352
(14-methyl-13,15-dioxo-4-thia-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecan-3-yl) acetate (PubChem CID 90482352) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is (14-methyl-13,15-dioxo-4-thia-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecan-3-yl) acetate.
| Compound Name | (14-methyl-13,15-dioxo-4-thia-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecan-3-yl) acetate |
|---|---|
| PubChem CID | 90482352 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (14-methyl-13,15-dioxo-4-thia-12,14,16-triazaheptacyclo[7.7.0.02,6.02,7.06,11.08,10.012,16]hexadecan-3-yl) acetate |
| SMILES | CC(=O)OC1SCC23C4C5C6C5C2C13C6n1c(=O)n(C)c(=O)n14 |
| InChI | InChI=1S/C15H15N3O4S/c1-4(19)22-11-15-8-5-6-7(5)10(15)18-13(21)16(2)12(20)17(18)9(6)14(8,15)3-23-11/h5-11H,3H2,1-2H3 |
| InChIKey | PFQSZGZIWCQOPR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 75.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |