About [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate
[7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate (PubChem CID 90482392) has the molecular formula C13H20O6S2
and a molecular weight of 336.43 g/mol. Its IUPAC name is [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate |
| PubChem CID | 90482392 |
| Molecular Formula | C13H20O6S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1C2C=CC(C1COS(C)(=O)=O)C1CC21 |
| InChI | InChI=1S/C13H20O6S2/c1-20(14,15)18-6-12-8-3-4-9(11-5-10(8)11)13(12)7-19-21(2,16)17/h3-4,8-13H,5-7H2,1-2H3 |
| InChIKey | AANDNWOQWGVROB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate?
The IUPAC name of [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate (CID 90482392) is [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate.
What is the SMILES notation for [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate?
The canonical SMILES for [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate is CS(=O)(=O)OCC1C2C=CC(C1COS(C)(=O)=O)C1CC21.
What is the InChIKey of [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate?
The InChIKey is AANDNWOQWGVROB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O6S2/c1-20(14,15)18-6-12-8-3-4-9(11-5-10(8)11)13(12)7-19-21(2,16)17/h3-4,8-13H,5-7H2,1-2H3.
What are the key properties of [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate?
[7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate has a molecular weight of 336.43 g/mol, XLogP of 0.62, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(methylsulfonyloxymethyl)-6-tricyclo[3.2.2.02,4]non-8-enyl]methyl methanesulfonate is sourced from PubChem (CID 90482392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).