About 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene
12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene (PubChem CID 90482420) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene.
Molecular Properties
| Compound Name | 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene |
| PubChem CID | 90482420 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene |
| SMILES | O=NN1CC23CC=CCC2(CC=CC3)C1 |
| InChI | InChI=1S/C12H16N2O/c15-13-14-9-11-5-1-2-6-12(11,10-14)8-4-3-7-11/h1-4H,5-10H2 |
| InChIKey | WEOFLFZNFTXTFJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene?
The IUPAC name of 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene (CID 90482420) is 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene.
What is the SMILES notation for 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene?
The canonical SMILES for 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene is O=NN1CC23CC=CCC2(CC=CC3)C1.
What is the InChIKey of 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene?
The InChIKey is WEOFLFZNFTXTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c15-13-14-9-11-5-1-2-6-12(11,10-14)8-4-3-7-11/h1-4H,5-10H2.
What are the key properties of 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene?
12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene has a molecular weight of 204.27 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-nitroso-12-azatricyclo[4.4.3.01,6]trideca-3,8-diene is sourced from PubChem (CID 90482420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).