C15H15N3O2 — CID 90482513
15-methyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-4-ene-14,16-dione (PubChem CID 90482513) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 15-methyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-4-ene-14,16-dione.
| Compound Name | 15-methyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-4-ene-14,16-dione |
|---|---|
| PubChem CID | 90482513 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 15-methyl-13,15,17-triazaheptacyclo[8.7.0.02,7.02,8.07,12.09,11.013,17]heptadec-4-ene-14,16-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C3C4C3C3C5(CC=CCC135)C42 |
| InChI | InChI=1S/C15H15N3O2/c1-16-12(19)17-10-7-6-8(7)11(18(17)13(16)20)15-5-3-2-4-14(10,15)9(6)15/h2-3,6-11H,4-5H2,1H3 |
| InChIKey | WDYAGNOENDYYHH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|