C16H16O2 — CID 90482695
pentacyclo[9.2.2.13,9.02,10.04,8]hexadeca-2(10),12-diene-5,7-dione (PubChem CID 90482695) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is pentacyclo[9.2.2.13,9.02,10.04,8]hexadeca-2(10),12-diene-5,7-dione.
| Compound Name | pentacyclo[9.2.2.13,9.02,10.04,8]hexadeca-2(10),12-diene-5,7-dione |
|---|---|
| PubChem CID | 90482695 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | pentacyclo[9.2.2.13,9.02,10.04,8]hexadeca-2(10),12-diene-5,7-dione |
| SMILES | O=C1CC(=O)C2C3CC(C4=C3C3C=CC4CC3)C12 |
| InChI | InChI=1S/C16H16O2/c17-11-6-12(18)16-10-5-9(15(11)16)13-7-1-2-8(4-3-7)14(10)13/h1-2,7-10,15-16H,3-6H2 |
| InChIKey | MWAKZAVUDIMQLS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|