C14H16O3S — CID 90482706
(1S,7R)-1-phenyl-4-oxa-9λ6-thiatricyclo[5.3.0.03,5]decane 9,9-dioxide (PubChem CID 90482706) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is (1S,7R)-1-phenyl-4-oxa-9λ6-thiatricyclo[5.3.0.03,5]decane 9,9-dioxide.
| Compound Name | (1S,7R)-1-phenyl-4-oxa-9λ6-thiatricyclo[5.3.0.03,5]decane 9,9-dioxide |
|---|---|
| PubChem CID | 90482706 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1S,7R)-1-phenyl-4-oxa-9λ6-thiatricyclo[5.3.0.03,5]decane 9,9-dioxide |
| SMILES | O=S1(=O)C[C@@H]2CC3OC3C[C@]2(c2ccccc2)C1 |
| InChI | InChI=1S/C14H16O3S/c15-18(16)8-11-6-12-13(17-12)7-14(11,9-18)10-4-2-1-3-5-10/h1-5,11-13H,6-9H2/t11-,12?,13?,14+/m0/s1 |
| InChIKey | JHSYGAFYGPNGTK-GFJIZPEISA-N |
| XLogP | 1.53 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|