C11H13N3O2 — CID 90482738
(8Z)-4-methyl-2,4,6-triazatricyclo[5.4.2.02,6]trideca-8,12-diene-3,5-dione (PubChem CID 90482738) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is (8Z)-4-methyl-2,4,6-triazatricyclo[5.4.2.02,6]trideca-8,12-diene-3,5-dione.
| Compound Name | (8Z)-4-methyl-2,4,6-triazatricyclo[5.4.2.02,6]trideca-8,12-diene-3,5-dione |
|---|---|
| PubChem CID | 90482738 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (8Z)-4-methyl-2,4,6-triazatricyclo[5.4.2.02,6]trideca-8,12-diene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2/C=C\CC1 |
| InChI | InChI=1S/C11H13N3O2/c1-12-10(15)13-8-4-2-3-5-9(7-6-8)14(13)11(12)16/h2,4,6-9H,3,5H2,1H3/b4-2- |
| InChIKey | BBPVVFDJHGXVRK-RQOWECAXSA-N |
| XLogP | 0.35 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|