C22H26O2 — CID 90482763
(3R,13R)-3,13-dimethyloctacyclo[9.9.0.02,15.03,10.05,9.05,12.013,20.015,19]icosane-4,14-dione (PubChem CID 90482763) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (3R,13R)-3,13-dimethyloctacyclo[9.9.0.02,15.03,10.05,9.05,12.013,20.015,19]icosane-4,14-dione.
| Compound Name | (3R,13R)-3,13-dimethyloctacyclo[9.9.0.02,15.03,10.05,9.05,12.013,20.015,19]icosane-4,14-dione |
|---|---|
| PubChem CID | 90482763 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (3R,13R)-3,13-dimethyloctacyclo[9.9.0.02,15.03,10.05,9.05,12.013,20.015,19]icosane-4,14-dione |
| SMILES | CC12C(=O)C34CCCC3C1C1C3C2C25CCCC2C3[C@@](C)(C5=O)C14 |
| InChI | InChI=1S/C22H26O2/c1-19-13-9-5-3-8-22(9,17(19)23)16-11(13)12-14-10-6-4-7-21(10,15(12)19)18(24)20(14,16)2/h9-16H,3-8H2,1-2H3/t9?,10?,11?,12?,13?,14?,15?,16?,19-,20?,21?,22?/m1/s1 |
| InChIKey | GCPRYOQVJZFWGP-LTMBHVOXSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |