About 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride
3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride (PubChem CID 90484264) has the molecular formula C5H9ClN4O2
and a molecular weight of 192.61 g/mol. Its IUPAC name is 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride |
| PubChem CID | 90484264 |
| Molecular Formula | C5H9ClN4O2 |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride |
| SMILES | Cl.Nc1ncn(CCC(=O)O)n1 |
| InChI | InChI=1S/C5H8N4O2.ClH/c6-5-7-3-9(8-5)2-1-4(10)11;/h3H,1-2H2,(H2,6,8)(H,10,11);1H |
| InChIKey | PSGXNSULLFMTIB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride?
The IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride (CID 90484264) is 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride?
The canonical SMILES for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride is Cl.Nc1ncn(CCC(=O)O)n1.
What is the InChIKey of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride?
The InChIKey is PSGXNSULLFMTIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2.ClH/c6-5-7-3-9(8-5)2-1-4(10)11;/h3H,1-2H2,(H2,6,8)(H,10,11);1H.
What are the key properties of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride?
3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride has a molecular weight of 192.61 g/mol, XLogP of -0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 90484264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).