C18H15Cl2F3N8O2 — CID 90484465
2-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 90484465) has the molecular formula C18H15Cl2F3N8O2 and a molecular weight of 503.27 g/mol. Its IUPAC name is 2-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 2-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 90484465 |
| Molecular Formula | C18H15Cl2F3N8O2 |
| Molecular Weight | 503.27 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-N-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]-6-N-methyl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | CNc1nc(N/N=C/c2cc([N+](=O)[O-])ccc2Cl)nc(Nc2cccc(C(F)(F)F)c2)n1.Cl |
| InChI | InChI=1S/C18H14ClF3N8O2.ClH/c1-23-15-26-16(25-12-4-2-3-11(8-12)18(20,21)22)28-17(27-15)29-24-9-10-7-13(30(31)32)5-6-14(10)19;/h2-9H,1H3,(H3,23,25,26,27,28,29);1H/b24-9+; |
| InChIKey | XOVCEPQSLRMTHW-REHAKMGWSA-N |
| XLogP | 5.11 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|