C18H16Cl2N2O3S — CID 90484546
(1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one;N,N-dimethylformamide (PubChem CID 90484546) has the molecular formula C18H16Cl2N2O3S and a molecular weight of 411.31 g/mol. Its IUPAC name is (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one;N,N-dimethylformamide.
| Compound Name | (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one;N,N-dimethylformamide |
|---|---|
| PubChem CID | 90484546 |
| Molecular Formula | C18H16Cl2N2O3S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (1E)-1-[(3,4-dichlorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one;N,N-dimethylformamide |
| SMILES | CN(C)C=O.Cc1cc2c(c(=S)[nH]1)C(=O)O/C2=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2NO2S.C3H7NO/c1-7-4-9-12(20-15(19)13(9)14(21)18-7)6-8-2-3-10(16)11(17)5-8;1-4(2)3-5/h2-6H,1H3,(H,18,21);3H,1-2H3/b12-6+; |
| InChIKey | FQFCVXURKQDRMJ-WXIWBVQFSA-N |
| XLogP | 4.73 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|