C47H38N2O4 — CID 90484882
2-anthracen-9-yl-4,5-bis(4-methoxyphenyl)-1H-imidazole;1,2-bis(4-methylphenyl)ethane-1,2-dione (PubChem CID 90484882) has the molecular formula C47H38N2O4 and a molecular weight of 694.83 g/mol. Its IUPAC name is 2-anthracen-9-yl-4,5-bis(4-methoxyphenyl)-1H-imidazole;1,2-bis(4-methylphenyl)ethane-1,2-dione.
| Compound Name | 2-anthracen-9-yl-4,5-bis(4-methoxyphenyl)-1H-imidazole;1,2-bis(4-methylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 90484882 |
| Molecular Formula | C47H38N2O4 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 2-anthracen-9-yl-4,5-bis(4-methoxyphenyl)-1H-imidazole;1,2-bis(4-methylphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(-c2nc(-c3c4ccccc4cc4ccccc34)[nH]c2-c2ccc(OC)cc2)cc1.Cc1ccc(C(=O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H24N2O2.C16H14O2/c1-34-24-15-11-20(12-16-24)29-30(21-13-17-25(35-2)18-14-21)33-31(32-29)28-26-9-5-3-7-22(26)19-23-8-4-6-10-27(23)28;1-11-3-7-13(8-4-11)15(17)16(18)14-9-5-12(2)6-10-14/h3-19H,1-2H3,(H,32,33);3-10H,1-2H3 |
| InChIKey | AMCOGVGUYSBQSC-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|